C19H28NO4+ — CID 167315223
2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate (PubChem CID 167315223) has the molecular formula C19H28NO4+ and a molecular weight of 334.44 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 167315223 |
| Molecular Formula | C19H28NO4+ |
| Molecular Weight | 334.44 g/mol |
| Exact Mass | 334.20 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(2,5-dimethoxyphenyl)prop-2-enoate |
| SMILES | COc1ccc(OC)c(/C=C/C(=O)OC(C)(C)C2CC[NH2+]CC2)c1 |
| InChI | InChI=1S/C19H27NO4/c1-19(2,15-9-11-20-12-10-15)24-18(21)8-5-14-13-16(22-3)6-7-17(14)23-4/h5-8,13,15,20H,9-12H2,1-4H3/p+1/b8-5+ |
| InChIKey | VTYFJCBWWOOWEB-VMPITWQZSA-O |
| XLogP | 2.01 |
| TPSA | 61.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.44 |
| LogP ≤ 5 | 2.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|