C19H26NO4+ — CID 167315167
2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(4-acetyloxyphenyl)prop-2-enoate (PubChem CID 167315167) has the molecular formula C19H26NO4+ and a molecular weight of 332.42 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(4-acetyloxyphenyl)prop-2-enoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(4-acetyloxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 167315167 |
| Molecular Formula | C19H26NO4+ |
| Molecular Weight | 332.42 g/mol |
| Exact Mass | 332.19 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(4-acetyloxyphenyl)prop-2-enoate |
| SMILES | CC(=O)Oc1ccc(/C=C/C(=O)OC(C)(C)C2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C19H25NO4/c1-14(21)23-17-7-4-15(5-8-17)6-9-18(22)24-19(2,3)16-10-12-20-13-11-16/h4-9,16,20H,10-13H2,1-3H3/p+1/b9-6+ |
| InChIKey | KIPAAANZRWAEBG-RMKNXTFCSA-O |
| XLogP | 1.92 |
| TPSA | 69.21 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.42 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|