C14H27N2O2+ — CID 167315528
2-piperidin-1-ium-4-ylpropan-2-yl (E)-4-(dimethylamino)but-2-enoate (PubChem CID 167315528) has the molecular formula C14H27N2O2+ and a molecular weight of 255.38 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl (E)-4-(dimethylamino)but-2-enoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl (E)-4-(dimethylamino)but-2-enoate |
|---|---|
| PubChem CID | 167315528 |
| Molecular Formula | C14H27N2O2+ |
| Molecular Weight | 255.38 g/mol |
| Exact Mass | 255.21 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl (E)-4-(dimethylamino)but-2-enoate |
| SMILES | CN(C)C/C=C/C(=O)OC(C)(C)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C14H26N2O2/c1-14(2,12-7-9-15-10-8-12)18-13(17)6-5-11-16(3)4/h5-6,12,15H,7-11H2,1-4H3/p+1/b6-5+ |
| InChIKey | IJYJOXBBNMCMDQ-AATRIKPKSA-O |
| XLogP | 0.40 |
| TPSA | 46.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 255.38 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|