C20H30NO3+ — CID 167316288
2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(4-propoxyphenyl)prop-2-enoate (PubChem CID 167316288) has the molecular formula C20H30NO3+ and a molecular weight of 332.46 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(4-propoxyphenyl)prop-2-enoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(4-propoxyphenyl)prop-2-enoate |
|---|---|
| PubChem CID | 167316288 |
| Molecular Formula | C20H30NO3+ |
| Molecular Weight | 332.46 g/mol |
| Exact Mass | 332.22 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl (E)-3-(4-propoxyphenyl)prop-2-enoate |
| SMILES | CCCOc1ccc(/C=C/C(=O)OC(C)(C)C2CC[NH2+]CC2)cc1 |
| InChI | InChI=1S/C20H29NO3/c1-4-15-23-18-8-5-16(6-9-18)7-10-19(22)24-20(2,3)17-11-13-21-14-12-17/h5-10,17,21H,4,11-15H2,1-3H3/p+1/b10-7+ |
| InChIKey | GUOKSICKZBUBPP-JXMROGBWSA-O |
| XLogP | 2.78 |
| TPSA | 52.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 332.46 |
| LogP ≤ 5 | 2.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|