C17H22BrNO2 — CID 155605294
2-piperidin-4-ylpropan-2-yl (E)-3-(4-bromophenyl)prop-2-enoate (PubChem CID 155605294) has the molecular formula C17H22BrNO2 and a molecular weight of 352.27 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl (E)-3-(4-bromophenyl)prop-2-enoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl (E)-3-(4-bromophenyl)prop-2-enoate |
|---|---|
| PubChem CID | 155605294 |
| Molecular Formula | C17H22BrNO2 |
| Molecular Weight | 352.27 g/mol |
| Exact Mass | 351.08 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl (E)-3-(4-bromophenyl)prop-2-enoate |
| SMILES | CC(C)(OC(=O)/C=C/c1ccc(Br)cc1)C1CCNCC1 |
| InChI | InChI=1S/C17H22BrNO2/c1-17(2,14-9-11-19-12-10-14)21-16(20)8-5-13-3-6-15(18)7-4-13/h3-8,14,19H,9-12H2,1-2H3/b8-5+ |
| InChIKey | XDQPCANJGLLUBR-VMPITWQZSA-N |
| XLogP | 3.78 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 352.27 |
| LogP ≤ 5 | 3.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|