C18H26BrNO2 — CID 155605361
2-piperidin-4-ylpropan-2-yl 4-(4-bromophenyl)butanoate (PubChem CID 155605361) has the molecular formula C18H26BrNO2 and a molecular weight of 368.32 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 4-(4-bromophenyl)butanoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 4-(4-bromophenyl)butanoate |
|---|---|
| PubChem CID | 155605361 |
| Molecular Formula | C18H26BrNO2 |
| Molecular Weight | 368.32 g/mol |
| Exact Mass | 367.11 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 4-(4-bromophenyl)butanoate |
| SMILES | CC(C)(OC(=O)CCCc1ccc(Br)cc1)C1CCNCC1 |
| InChI | InChI=1S/C18H26BrNO2/c1-18(2,15-10-12-20-13-11-15)22-17(21)5-3-4-14-6-8-16(19)9-7-14/h6-9,15,20H,3-5,10-13H2,1-2H3 |
| InChIKey | ZXKRLBAUUCZHCT-UHFFFAOYSA-N |
| XLogP | 4.09 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 368.32 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |