About 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate
2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate (PubChem CID 155605208) has the molecular formula C16H22BrNO2
and a molecular weight of 340.26 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate.
Molecular Properties
| Compound Name | 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate |
| PubChem CID | 155605208 |
| Molecular Formula | C16H22BrNO2 |
| Molecular Weight | 340.26 g/mol |
| Exact Mass | 339.08 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate |
| SMILES | CC(C)(OC(=O)Cc1ccccc1Br)C1CCNCC1 |
| InChI | InChI=1S/C16H22BrNO2/c1-16(2,13-7-9-18-10-8-13)20-15(19)11-12-5-3-4-6-14(12)17/h3-6,13,18H,7-11H2,1-2H3 |
| InChIKey | PSCMAFRPVVAHKS-UHFFFAOYSA-N |
| XLogP | 3.31 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 340.26 |
| LogP ≤ 5 | 3.31 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate?
The IUPAC name of 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate (CID 155605208) is 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate.
What is the SMILES notation for 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate?
The canonical SMILES for 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate is CC(C)(OC(=O)Cc1ccccc1Br)C1CCNCC1.
What is the InChIKey of 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate?
The InChIKey is PSCMAFRPVVAHKS-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H22BrNO2/c1-16(2,13-7-9-18-10-8-13)20-15(19)11-12-5-3-4-6-14(12)17/h3-6,13,18H,7-11H2,1-2H3.
What are the key properties of 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate?
2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate has a molecular weight of 340.26 g/mol, XLogP of 3.31, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-piperidin-4-ylpropan-2-yl 2-(2-bromophenyl)acetate is sourced from PubChem (CID 155605208), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).