C17H25NO3 — CID 155075328
2-piperidin-4-ylpropan-2-yl 2-hydroxy-2-phenylpropanoate (PubChem CID 155075328) has the molecular formula C17H25NO3 and a molecular weight of 291.39 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 2-hydroxy-2-phenylpropanoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 2-hydroxy-2-phenylpropanoate |
|---|---|
| PubChem CID | 155075328 |
| Molecular Formula | C17H25NO3 |
| Molecular Weight | 291.39 g/mol |
| Exact Mass | 291.18 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 2-hydroxy-2-phenylpropanoate |
| SMILES | CC(O)(C(=O)OC(C)(C)C1CCNCC1)c1ccccc1 |
| InChI | InChI=1S/C17H25NO3/c1-16(2,13-9-11-18-12-10-13)21-15(19)17(3,20)14-7-5-4-6-8-14/h4-8,13,18,20H,9-12H2,1-3H3 |
| InChIKey | NWOGMVFLRCPGBT-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 58.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.39 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |