C40H68N4O8 — CID 155075585
tetrakis(2-piperidin-4-ylpropan-2-yl) cyclobutane-1,2,3,4-tetracarboxylate (PubChem CID 155075585) has the molecular formula C40H68N4O8 and a molecular weight of 733.00 g/mol. Its IUPAC name is tetrakis(2-piperidin-4-ylpropan-2-yl) cyclobutane-1,2,3,4-tetracarboxylate.
| Compound Name | tetrakis(2-piperidin-4-ylpropan-2-yl) cyclobutane-1,2,3,4-tetracarboxylate |
|---|---|
| PubChem CID | 155075585 |
| Molecular Formula | C40H68N4O8 |
| Molecular Weight | 733.00 g/mol |
| Exact Mass | 732.50 |
| IUPAC Name | tetrakis(2-piperidin-4-ylpropan-2-yl) cyclobutane-1,2,3,4-tetracarboxylate |
| SMILES | CC(C)(OC(=O)C1C(C(=O)OC(C)(C)C2CCNCC2)C(C(=O)OC(C)(C)C2CCNCC2)C1C(=O)OC(C)(C)C1CCNCC1)C1CCNCC1 |
| InChI | InChI=1S/C40H68N4O8/c1-37(2,25-9-17-41-18-10-25)49-33(45)29-30(34(46)50-38(3,4)26-11-19-42-20-12-26)32(36(48)52-40(7,8)28-15-23-44-24-16-28)31(29)35(47)51-39(5,6)27-13-21-43-22-14-27/h25-32,41-44H,9-24H2,1-8H3 |
| InChIKey | UGYNLFHMSCUJQW-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 153.32 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 52 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.00 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'} |
|---|