About bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate
bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate (PubChem CID 155076100) has the molecular formula C24H42N2O4
and a molecular weight of 422.61 g/mol. Its IUPAC name is bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate.
Molecular Properties
| Compound Name | bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate |
| PubChem CID | 155076100 |
| Molecular Formula | C24H42N2O4 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate |
| SMILES | CC(C)(OC(=O)C1CCCCC1C(=O)OC(C)(C)C1CCNCC1)C1CCNCC1 |
| InChI | InChI=1S/C24H42N2O4/c1-23(2,17-9-13-25-14-10-17)29-21(27)19-7-5-6-8-20(19)22(28)30-24(3,4)18-11-15-26-16-12-18/h17-20,25-26H,5-16H2,1-4H3 |
| InChIKey | JDJGHEMFNZZEJR-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate?
The IUPAC name of bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate (CID 155076100) is bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate.
What is the SMILES notation for bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate?
The canonical SMILES for bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate is CC(C)(OC(=O)C1CCCCC1C(=O)OC(C)(C)C1CCNCC1)C1CCNCC1.
What is the InChIKey of bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate?
The InChIKey is JDJGHEMFNZZEJR-UHFFFAOYSA-N. The full InChI is InChI=1S/C24H42N2O4/c1-23(2,17-9-13-25-14-10-17)29-21(27)19-7-5-6-8-20(19)22(28)30-24(3,4)18-11-15-26-16-12-18/h17-20,25-26H,5-16H2,1-4H3.
What are the key properties of bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate?
bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate has a molecular weight of 422.61 g/mol, XLogP of 3.44, 6 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,2-dicarboxylate is sourced from PubChem (CID 155076100), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).