C10H16Br3NO2 — CID 155605248
2-piperidin-4-ylpropan-2-yl 2,2,2-tribromoacetate (PubChem CID 155605248) has the molecular formula C10H16Br3NO2 and a molecular weight of 421.96 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 2,2,2-tribromoacetate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 2,2,2-tribromoacetate |
|---|---|
| PubChem CID | 155605248 |
| Molecular Formula | C10H16Br3NO2 |
| Molecular Weight | 421.96 g/mol |
| Exact Mass | 418.87 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 2,2,2-tribromoacetate |
| SMILES | CC(C)(OC(=O)C(Br)(Br)Br)C1CCNCC1 |
| InChI | InChI=1S/C10H16Br3NO2/c1-9(2,7-3-5-14-6-4-7)16-8(15)10(11,12)13/h7,14H,3-6H2,1-2H3 |
| InChIKey | RDEIFNJBZKQHHV-UHFFFAOYSA-N |
| XLogP | 3.15 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.96 |
| LogP ≤ 5 | 3.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|