C24H42N2O4 — CID 155075621
bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,4-dicarboxylate (PubChem CID 155075621) has the molecular formula C24H42N2O4 and a molecular weight of 422.61 g/mol. Its IUPAC name is bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,4-dicarboxylate.
| Compound Name | bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,4-dicarboxylate |
|---|---|
| PubChem CID | 155075621 |
| Molecular Formula | C24H42N2O4 |
| Molecular Weight | 422.61 g/mol |
| Exact Mass | 422.31 |
| IUPAC Name | bis(2-piperidin-4-ylpropan-2-yl) cyclohexane-1,4-dicarboxylate |
| SMILES | CC(C)(OC(=O)C1CCC(C(=O)OC(C)(C)C2CCNCC2)CC1)C1CCNCC1 |
| InChI | InChI=1S/C24H42N2O4/c1-23(2,19-9-13-25-14-10-19)29-21(27)17-5-7-18(8-6-17)22(28)30-24(3,4)20-11-15-26-16-12-20/h17-20,25-26H,5-16H2,1-4H3 |
| InChIKey | JIHDBHWYJLPQPF-UHFFFAOYSA-N |
| XLogP | 3.44 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.61 |
| LogP ≤ 5 | 3.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |