C12H21F2NO2 — CID 157326852
2-piperidin-4-ylpropan-2-yl 3,3-difluorobutanoate (PubChem CID 157326852) has the molecular formula C12H21F2NO2 and a molecular weight of 249.30 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 3,3-difluorobutanoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 3,3-difluorobutanoate |
|---|---|
| PubChem CID | 157326852 |
| Molecular Formula | C12H21F2NO2 |
| Molecular Weight | 249.30 g/mol |
| Exact Mass | 249.15 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 3,3-difluorobutanoate |
| SMILES | CC(F)(F)CC(=O)OC(C)(C)C1CCNCC1 |
| InChI | InChI=1S/C12H21F2NO2/c1-11(2,9-4-6-15-7-5-9)17-10(16)8-12(3,13)14/h9,15H,4-8H2,1-3H3 |
| InChIKey | UOFQYKNVJOIXJT-UHFFFAOYSA-N |
| XLogP | 2.35 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 249.30 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |