C16H23NO4 — CID 155075664
2-piperidin-4-ylpropan-2-yl 2-(2,5-dihydroxyphenyl)acetate (PubChem CID 155075664) has the molecular formula C16H23NO4 and a molecular weight of 293.36 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 2-(2,5-dihydroxyphenyl)acetate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 2-(2,5-dihydroxyphenyl)acetate |
|---|---|
| PubChem CID | 155075664 |
| Molecular Formula | C16H23NO4 |
| Molecular Weight | 293.36 g/mol |
| Exact Mass | 293.16 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 2-(2,5-dihydroxyphenyl)acetate |
| SMILES | CC(C)(OC(=O)Cc1cc(O)ccc1O)C1CCNCC1 |
| InChI | InChI=1S/C16H23NO4/c1-16(2,12-5-7-17-8-6-12)21-15(20)10-11-9-13(18)3-4-14(11)19/h3-4,9,12,17-19H,5-8,10H2,1-2H3 |
| InChIKey | HCHALBUJZQQVCF-UHFFFAOYSA-N |
| XLogP | 1.96 |
| TPSA | 78.79 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.36 |
| LogP ≤ 5 | 1.96 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'hydroquinone', 'substructure': 'N/A'} |
|---|