C21H27NO3 — CID 155075742
2-piperidin-4-ylpropan-2-yl 2-(7-methoxynaphthalen-1-yl)acetate (PubChem CID 155075742) has the molecular formula C21H27NO3 and a molecular weight of 341.45 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 2-(7-methoxynaphthalen-1-yl)acetate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 2-(7-methoxynaphthalen-1-yl)acetate |
|---|---|
| PubChem CID | 155075742 |
| Molecular Formula | C21H27NO3 |
| Molecular Weight | 341.45 g/mol |
| Exact Mass | 341.20 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 2-(7-methoxynaphthalen-1-yl)acetate |
| SMILES | COc1ccc2cccc(CC(=O)OC(C)(C)C3CCNCC3)c2c1 |
| InChI | InChI=1S/C21H27NO3/c1-21(2,17-9-11-22-12-10-17)25-20(23)13-16-6-4-5-15-7-8-18(24-3)14-19(15)16/h4-8,14,17,22H,9-13H2,1-3H3 |
| InChIKey | RJELHHZKVHNURA-UHFFFAOYSA-N |
| XLogP | 3.71 |
| TPSA | 47.56 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.45 |
| LogP ≤ 5 | 3.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |