C23H29NO2 — CID 155075781
2-piperidin-4-ylpropan-2-yl 3,3-diphenylpropanoate (PubChem CID 155075781) has the molecular formula C23H29NO2 and a molecular weight of 351.49 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl 3,3-diphenylpropanoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl 3,3-diphenylpropanoate |
|---|---|
| PubChem CID | 155075781 |
| Molecular Formula | C23H29NO2 |
| Molecular Weight | 351.49 g/mol |
| Exact Mass | 351.22 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl 3,3-diphenylpropanoate |
| SMILES | CC(C)(OC(=O)CC(c1ccccc1)c1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C23H29NO2/c1-23(2,20-13-15-24-16-14-20)26-22(25)17-21(18-9-5-3-6-10-18)19-11-7-4-8-12-19/h3-12,20-21,24H,13-17H2,1-2H3 |
| InChIKey | ALXFTOZLOXVUGV-UHFFFAOYSA-N |
| XLogP | 4.53 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.49 |
| LogP ≤ 5 | 4.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |