C17H23NO2 — CID 155075699
2-piperidin-4-ylpropan-2-yl (E)-3-phenylprop-2-enoate (PubChem CID 155075699) has the molecular formula C17H23NO2 and a molecular weight of 273.38 g/mol. Its IUPAC name is 2-piperidin-4-ylpropan-2-yl (E)-3-phenylprop-2-enoate.
| Compound Name | 2-piperidin-4-ylpropan-2-yl (E)-3-phenylprop-2-enoate |
|---|---|
| PubChem CID | 155075699 |
| Molecular Formula | C17H23NO2 |
| Molecular Weight | 273.38 g/mol |
| Exact Mass | 273.17 |
| IUPAC Name | 2-piperidin-4-ylpropan-2-yl (E)-3-phenylprop-2-enoate |
| SMILES | CC(C)(OC(=O)/C=C/c1ccccc1)C1CCNCC1 |
| InChI | InChI=1S/C17H23NO2/c1-17(2,15-10-12-18-13-11-15)20-16(19)9-8-14-6-4-3-5-7-14/h3-9,15,18H,10-13H2,1-2H3/b9-8+ |
| InChIKey | KAURJPFTNBNZQY-CMDGGOBGSA-N |
| XLogP | 3.02 |
| TPSA | 38.33 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 273.38 |
| LogP ≤ 5 | 3.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|