C17H26NO3+ — CID 167315276
2-piperidin-1-ium-4-ylpropan-2-yl 3-hydroxy-3-phenylpropanoate (PubChem CID 167315276) has the molecular formula C17H26NO3+ and a molecular weight of 292.40 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 3-hydroxy-3-phenylpropanoate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-hydroxy-3-phenylpropanoate |
|---|---|
| PubChem CID | 167315276 |
| Molecular Formula | C17H26NO3+ |
| Molecular Weight | 292.40 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 3-hydroxy-3-phenylpropanoate |
| SMILES | CC(C)(OC(=O)CC(O)c1ccccc1)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C17H25NO3/c1-17(2,14-8-10-18-11-9-14)21-16(20)12-15(19)13-6-4-3-5-7-13/h3-7,14-15,18-19H,8-12H2,1-2H3/p+1 |
| InChIKey | LJTZRNMLCJRZDD-UHFFFAOYSA-O |
| XLogP | 1.41 |
| TPSA | 63.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.40 |
| LogP ≤ 5 | 1.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |