C17H26NO4+ — CID 167316415
2-piperidin-1-ium-4-ylpropan-2-yl 2-(2-methoxyphenoxy)acetate (PubChem CID 167316415) has the molecular formula C17H26NO4+ and a molecular weight of 308.40 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-(2-methoxyphenoxy)acetate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-(2-methoxyphenoxy)acetate |
|---|---|
| PubChem CID | 167316415 |
| Molecular Formula | C17H26NO4+ |
| Molecular Weight | 308.40 g/mol |
| Exact Mass | 308.19 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-(2-methoxyphenoxy)acetate |
| SMILES | COc1ccccc1OCC(=O)OC(C)(C)C1CC[NH2+]CC1 |
| InChI | InChI=1S/C17H25NO4/c1-17(2,13-8-10-18-11-9-13)22-16(19)12-21-15-7-5-4-6-14(15)20-3/h4-7,13,18H,8-12H2,1-3H3/p+1 |
| InChIKey | XYVXJMMLKPIGRV-UHFFFAOYSA-O |
| XLogP | 1.37 |
| TPSA | 61.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.40 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |