C18H27N2O3+ — CID 167315044
2-piperidin-1-ium-4-ylpropan-2-yl 2-[(3-methylbenzoyl)amino]acetate (PubChem CID 167315044) has the molecular formula C18H27N2O3+ and a molecular weight of 319.42 g/mol. Its IUPAC name is 2-piperidin-1-ium-4-ylpropan-2-yl 2-[(3-methylbenzoyl)amino]acetate.
| Compound Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-[(3-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 167315044 |
| Molecular Formula | C18H27N2O3+ |
| Molecular Weight | 319.42 g/mol |
| Exact Mass | 319.20 |
| IUPAC Name | 2-piperidin-1-ium-4-ylpropan-2-yl 2-[(3-methylbenzoyl)amino]acetate |
| SMILES | Cc1cccc(C(=O)NCC(=O)OC(C)(C)C2CC[NH2+]CC2)c1 |
| InChI | InChI=1S/C18H26N2O3/c1-13-5-4-6-14(11-13)17(22)20-12-16(21)23-18(2,3)15-7-9-19-10-8-15/h4-6,11,15,19H,7-10,12H2,1-3H3,(H,20,22)/p+1 |
| InChIKey | LDCWXSNLARGAJJ-UHFFFAOYSA-O |
| XLogP | 1.02 |
| TPSA | 72.01 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 319.42 |
| LogP ≤ 5 | 1.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |