C26H30N4O8 — CID 24980263
[2-[2-[[2-[2-[(3-methylbenzoyl)amino]acetyl]oxyacetyl]amino]ethylamino]-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate (PubChem CID 24980263) has the molecular formula C26H30N4O8 and a molecular weight of 526.55 g/mol. Its IUPAC name is [2-[2-[[2-[2-[(3-methylbenzoyl)amino]acetyl]oxyacetyl]amino]ethylamino]-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate.
| Compound Name | [2-[2-[[2-[2-[(3-methylbenzoyl)amino]acetyl]oxyacetyl]amino]ethylamino]-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 24980263 |
| Molecular Formula | C26H30N4O8 |
| Molecular Weight | 526.55 g/mol |
| Exact Mass | 526.21 |
| IUPAC Name | [2-[2-[[2-[2-[(3-methylbenzoyl)amino]acetyl]oxyacetyl]amino]ethylamino]-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate |
| SMILES | Cc1cccc(C(=O)NCC(=O)OCC(=O)NCCNC(=O)COC(=O)CNC(=O)c2cccc(C)c2)c1 |
| InChI | InChI=1S/C26H30N4O8/c1-17-5-3-7-19(11-17)25(35)29-13-23(33)37-15-21(31)27-9-10-28-22(32)16-38-24(34)14-30-26(36)20-8-4-6-18(2)12-20/h3-8,11-12H,9-10,13-16H2,1-2H3,(H,27,31)(H,28,32)(H,29,35)(H,30,36) |
| InChIKey | YJUUJSVAMUXFPP-UHFFFAOYSA-N |
| XLogP | -0.22 |
| TPSA | 169.00 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.55 |
| LogP ≤ 5 | -0.22 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|