C20H21N3O5 — CID 40676131
[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate (PubChem CID 40676131) has the molecular formula C20H21N3O5 and a molecular weight of 383.40 g/mol. Its IUPAC name is [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate.
| Compound Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate |
|---|---|
| PubChem CID | 40676131 |
| Molecular Formula | C20H21N3O5 |
| Molecular Weight | 383.40 g/mol |
| Exact Mass | 383.15 |
| IUPAC Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[(3-methylbenzoyl)amino]acetate |
| SMILES | CNC(=O)c1ccc(NC(=O)COC(=O)CNC(=O)c2cccc(C)c2)cc1 |
| InChI | InChI=1S/C20H21N3O5/c1-13-4-3-5-15(10-13)20(27)22-11-18(25)28-12-17(24)23-16-8-6-14(7-9-16)19(26)21-2/h3-10H,11-12H2,1-2H3,(H,21,26)(H,22,27)(H,23,24) |
| InChIKey | JTVXLTPDNMSUTM-UHFFFAOYSA-N |
| XLogP | 1.27 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.40 |
| LogP ≤ 5 | 1.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |