C20H18F3N3O5 — CID 27916887
[2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate (PubChem CID 27916887) has the molecular formula C20H18F3N3O5 and a molecular weight of 437.37 g/mol. Its IUPAC name is [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate.
| Compound Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
|---|---|
| PubChem CID | 27916887 |
| Molecular Formula | C20H18F3N3O5 |
| Molecular Weight | 437.37 g/mol |
| Exact Mass | 437.12 |
| IUPAC Name | [2-[4-(methylcarbamoyl)anilino]-2-oxoethyl] 2-[[4-(trifluoromethyl)benzoyl]amino]acetate |
| SMILES | CNC(=O)c1ccc(NC(=O)COC(=O)CNC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C20H18F3N3O5/c1-24-18(29)12-4-8-15(9-5-12)26-16(27)11-31-17(28)10-25-19(30)13-2-6-14(7-3-13)20(21,22)23/h2-9H,10-11H2,1H3,(H,24,29)(H,25,30)(H,26,27) |
| InChIKey | AZQUWCLXICMEIQ-UHFFFAOYSA-N |
| XLogP | 1.98 |
| TPSA | 113.60 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.37 |
| LogP ≤ 5 | 1.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |