C18H15F3N2O3 — CID 26681918
N-[2-(4-acetylanilino)-2-oxoethyl]-4-(trifluoromethyl)benzamide (PubChem CID 26681918) has the molecular formula C18H15F3N2O3 and a molecular weight of 364.32 g/mol. Its IUPAC name is N-[2-(4-acetylanilino)-2-oxoethyl]-4-(trifluoromethyl)benzamide.
| Compound Name | N-[2-(4-acetylanilino)-2-oxoethyl]-4-(trifluoromethyl)benzamide |
|---|---|
| PubChem CID | 26681918 |
| Molecular Formula | C18H15F3N2O3 |
| Molecular Weight | 364.32 g/mol |
| Exact Mass | 364.10 |
| IUPAC Name | N-[2-(4-acetylanilino)-2-oxoethyl]-4-(trifluoromethyl)benzamide |
| SMILES | CC(=O)c1ccc(NC(=O)CNC(=O)c2ccc(C(F)(F)F)cc2)cc1 |
| InChI | InChI=1S/C18H15F3N2O3/c1-11(24)12-4-8-15(9-5-12)23-16(25)10-22-17(26)13-2-6-14(7-3-13)18(19,20)21/h2-9H,10H2,1H3,(H,22,26)(H,23,25) |
| InChIKey | GZRFYJXMLXHRIH-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 75.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.32 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |