C19H19F3N2O5 — CID 26682580
3,4,5-trimethoxy-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]benzamide (PubChem CID 26682580) has the molecular formula C19H19F3N2O5 and a molecular weight of 412.36 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]benzamide |
|---|---|
| PubChem CID | 26682580 |
| Molecular Formula | C19H19F3N2O5 |
| Molecular Weight | 412.36 g/mol |
| Exact Mass | 412.12 |
| IUPAC Name | 3,4,5-trimethoxy-N-[2-oxo-2-[4-(trifluoromethyl)anilino]ethyl]benzamide |
| SMILES | COc1cc(C(=O)NCC(=O)Nc2ccc(C(F)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H19F3N2O5/c1-27-14-8-11(9-15(28-2)17(14)29-3)18(26)23-10-16(25)24-13-6-4-12(5-7-13)19(20,21)22/h4-9H,10H2,1-3H3,(H,23,26)(H,24,25) |
| InChIKey | CHRZIYBTFYPGNE-UHFFFAOYSA-N |
| XLogP | 3.10 |
| TPSA | 85.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.36 |
| LogP ≤ 5 | 3.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |