C19H21F3N2O4 — CID 109040860
3-[4-(trifluoromethyl)anilino]-N-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 109040860) has the molecular formula C19H21F3N2O4 and a molecular weight of 398.38 g/mol. Its IUPAC name is 3-[4-(trifluoromethyl)anilino]-N-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-[4-(trifluoromethyl)anilino]-N-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 109040860 |
| Molecular Formula | C19H21F3N2O4 |
| Molecular Weight | 398.38 g/mol |
| Exact Mass | 398.15 |
| IUPAC Name | 3-[4-(trifluoromethyl)anilino]-N-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | COc1cc(NC(=O)CCNc2ccc(C(F)(F)F)cc2)cc(OC)c1OC |
| InChI | InChI=1S/C19H21F3N2O4/c1-26-15-10-14(11-16(27-2)18(15)28-3)24-17(25)8-9-23-13-6-4-12(5-7-13)19(20,21)22/h4-7,10-11,23H,8-9H2,1-3H3,(H,24,25) |
| InChIKey | MHKWPUCVVUZYPH-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |