C20H26N2O5 — CID 109039839
3-(2-ethoxyanilino)-N-(3,4,5-trimethoxyphenyl)propanamide (PubChem CID 109039839) has the molecular formula C20H26N2O5 and a molecular weight of 374.44 g/mol. Its IUPAC name is 3-(2-ethoxyanilino)-N-(3,4,5-trimethoxyphenyl)propanamide.
| Compound Name | 3-(2-ethoxyanilino)-N-(3,4,5-trimethoxyphenyl)propanamide |
|---|---|
| PubChem CID | 109039839 |
| Molecular Formula | C20H26N2O5 |
| Molecular Weight | 374.44 g/mol |
| Exact Mass | 374.18 |
| IUPAC Name | 3-(2-ethoxyanilino)-N-(3,4,5-trimethoxyphenyl)propanamide |
| SMILES | CCOc1ccccc1NCCC(=O)Nc1cc(OC)c(OC)c(OC)c1 |
| InChI | InChI=1S/C20H26N2O5/c1-5-27-16-9-7-6-8-15(16)21-11-10-19(23)22-14-12-17(24-2)20(26-4)18(13-14)25-3/h6-9,12-13,21H,5,10-11H2,1-4H3,(H,22,23) |
| InChIKey | ABADBPOTJQUIDW-UHFFFAOYSA-N |
| XLogP | 3.55 |
| TPSA | 78.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 374.44 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |