C22H30N2O4 — CID 109037292
N-(2-tert-butylphenyl)-3-(3,4,5-trimethoxyanilino)propanamide (PubChem CID 109037292) has the molecular formula C22H30N2O4 and a molecular weight of 386.49 g/mol. Its IUPAC name is N-(2-tert-butylphenyl)-3-(3,4,5-trimethoxyanilino)propanamide.
| Compound Name | N-(2-tert-butylphenyl)-3-(3,4,5-trimethoxyanilino)propanamide |
|---|---|
| PubChem CID | 109037292 |
| Molecular Formula | C22H30N2O4 |
| Molecular Weight | 386.49 g/mol |
| Exact Mass | 386.22 |
| IUPAC Name | N-(2-tert-butylphenyl)-3-(3,4,5-trimethoxyanilino)propanamide |
| SMILES | COc1cc(NCCC(=O)Nc2ccccc2C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C22H30N2O4/c1-22(2,3)16-9-7-8-10-17(16)24-20(25)11-12-23-15-13-18(26-4)21(28-6)19(14-15)27-5/h7-10,13-14,23H,11-12H2,1-6H3,(H,24,25) |
| InChIKey | GHBUMPUNQOSLCD-UHFFFAOYSA-N |
| XLogP | 4.45 |
| TPSA | 68.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.49 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'anil_di_alk_C(246)', 'substructure': 'N/A'} |
|---|