C21H27NO5 — CID 24536655
2-(2-tert-butylphenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide (PubChem CID 24536655) has the molecular formula C21H27NO5 and a molecular weight of 373.45 g/mol. Its IUPAC name is 2-(2-tert-butylphenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide.
| Compound Name | 2-(2-tert-butylphenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide |
|---|---|
| PubChem CID | 24536655 |
| Molecular Formula | C21H27NO5 |
| Molecular Weight | 373.45 g/mol |
| Exact Mass | 373.19 |
| IUPAC Name | 2-(2-tert-butylphenoxy)-N-(3,4,5-trimethoxyphenyl)acetamide |
| SMILES | COc1cc(NC(=O)COc2ccccc2C(C)(C)C)cc(OC)c1OC |
| InChI | InChI=1S/C21H27NO5/c1-21(2,3)15-9-7-8-10-16(15)27-13-19(23)22-14-11-17(24-4)20(26-6)18(12-14)25-5/h7-12H,13H2,1-6H3,(H,22,23) |
| InChIKey | ASJVYXMCVHQBHK-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 66.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.45 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |