C17H15NO7 — CID 880340
5-[[2-(2-methoxyphenoxy)acetyl]amino]benzene-1,3-dicarboxylic acid (PubChem CID 880340) has the molecular formula C17H15NO7 and a molecular weight of 345.31 g/mol. Its IUPAC name is 5-[[2-(2-methoxyphenoxy)acetyl]amino]benzene-1,3-dicarboxylic acid.
| Compound Name | 5-[[2-(2-methoxyphenoxy)acetyl]amino]benzene-1,3-dicarboxylic acid |
|---|---|
| PubChem CID | 880340 |
| Molecular Formula | C17H15NO7 |
| Molecular Weight | 345.31 g/mol |
| Exact Mass | 345.08 |
| IUPAC Name | 5-[[2-(2-methoxyphenoxy)acetyl]amino]benzene-1,3-dicarboxylic acid |
| SMILES | COc1ccccc1OCC(=O)Nc1cc(C(=O)O)cc(C(=O)O)c1 |
| InChI | InChI=1S/C17H15NO7/c1-24-13-4-2-3-5-14(13)25-9-15(19)18-12-7-10(16(20)21)6-11(8-12)17(22)23/h2-8H,9H2,1H3,(H,18,19)(H,20,21)(H,22,23) |
| InChIKey | DTXIBNSMQBFNLR-UHFFFAOYSA-N |
| XLogP | 2.11 |
| TPSA | 122.16 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 345.31 |
| LogP ≤ 5 | 2.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |