C25H25N3O5 — CID 121063227
N-(2-benzamidoethyl)-4-[[2-(2-methoxyphenoxy)acetyl]amino]benzamide (PubChem CID 121063227) has the molecular formula C25H25N3O5 and a molecular weight of 447.49 g/mol. Its IUPAC name is N-(2-benzamidoethyl)-4-[[2-(2-methoxyphenoxy)acetyl]amino]benzamide.
| Compound Name | N-(2-benzamidoethyl)-4-[[2-(2-methoxyphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 121063227 |
| Molecular Formula | C25H25N3O5 |
| Molecular Weight | 447.49 g/mol |
| Exact Mass | 447.18 |
| IUPAC Name | N-(2-benzamidoethyl)-4-[[2-(2-methoxyphenoxy)acetyl]amino]benzamide |
| SMILES | COc1ccccc1OCC(=O)Nc1ccc(C(=O)NCCNC(=O)c2ccccc2)cc1 |
| InChI | InChI=1S/C25H25N3O5/c1-32-21-9-5-6-10-22(21)33-17-23(29)28-20-13-11-19(12-14-20)25(31)27-16-15-26-24(30)18-7-3-2-4-8-18/h2-14H,15-17H2,1H3,(H,26,30)(H,27,31)(H,28,29) |
| InChIKey | SAXRBLOPNPYABT-UHFFFAOYSA-N |
| XLogP | 2.87 |
| TPSA | 105.76 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 447.49 |
| LogP ≤ 5 | 2.87 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|