C24H25N3O4 — CID 121062341
4-[(2-naphthalen-1-yloxyacetyl)amino]-N-[2-(propanoylamino)ethyl]benzamide (PubChem CID 121062341) has the molecular formula C24H25N3O4 and a molecular weight of 419.48 g/mol. Its IUPAC name is 4-[(2-naphthalen-1-yloxyacetyl)amino]-N-[2-(propanoylamino)ethyl]benzamide.
| Compound Name | 4-[(2-naphthalen-1-yloxyacetyl)amino]-N-[2-(propanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 121062341 |
| Molecular Formula | C24H25N3O4 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.18 |
| IUPAC Name | 4-[(2-naphthalen-1-yloxyacetyl)amino]-N-[2-(propanoylamino)ethyl]benzamide |
| SMILES | CCC(=O)NCCNC(=O)c1ccc(NC(=O)COc2cccc3ccccc23)cc1 |
| InChI | InChI=1S/C24H25N3O4/c1-2-22(28)25-14-15-26-24(30)18-10-12-19(13-11-18)27-23(29)16-31-21-9-5-7-17-6-3-4-8-20(17)21/h3-13H,2,14-16H2,1H3,(H,25,28)(H,26,30)(H,27,29) |
| InChIKey | LDIASUZRFHKUCT-UHFFFAOYSA-N |
| XLogP | 3.11 |
| TPSA | 96.53 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|