C15H21N3O3 — CID 121062260
4-(propanoylamino)-N-[2-(propanoylamino)ethyl]benzamide (PubChem CID 121062260) has the molecular formula C15H21N3O3 and a molecular weight of 291.35 g/mol. Its IUPAC name is 4-(propanoylamino)-N-[2-(propanoylamino)ethyl]benzamide.
| Compound Name | 4-(propanoylamino)-N-[2-(propanoylamino)ethyl]benzamide |
|---|---|
| PubChem CID | 121062260 |
| Molecular Formula | C15H21N3O3 |
| Molecular Weight | 291.35 g/mol |
| Exact Mass | 291.16 |
| IUPAC Name | 4-(propanoylamino)-N-[2-(propanoylamino)ethyl]benzamide |
| SMILES | CCC(=O)NCCNC(=O)c1ccc(NC(=O)CC)cc1 |
| InChI | InChI=1S/C15H21N3O3/c1-3-13(19)16-9-10-17-15(21)11-5-7-12(8-6-11)18-14(20)4-2/h5-8H,3-4,9-10H2,1-2H3,(H,16,19)(H,17,21)(H,18,20) |
| InChIKey | UIEAJKDBDUZDRG-UHFFFAOYSA-N |
| XLogP | 1.29 |
| TPSA | 87.30 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 291.35 |
| LogP ≤ 5 | 1.29 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|