C29H33N3O7 — CID 2901481
N-tert-butyl-3,5-bis[[2-(2-methoxyphenoxy)acetyl]amino]benzamide (PubChem CID 2901481) has the molecular formula C29H33N3O7 and a molecular weight of 535.60 g/mol. Its IUPAC name is N-tert-butyl-3,5-bis[[2-(2-methoxyphenoxy)acetyl]amino]benzamide.
| Compound Name | N-tert-butyl-3,5-bis[[2-(2-methoxyphenoxy)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 2901481 |
| Molecular Formula | C29H33N3O7 |
| Molecular Weight | 535.60 g/mol |
| Exact Mass | 535.23 |
| IUPAC Name | N-tert-butyl-3,5-bis[[2-(2-methoxyphenoxy)acetyl]amino]benzamide |
| SMILES | COc1ccccc1OCC(=O)Nc1cc(NC(=O)COc2ccccc2OC)cc(C(=O)NC(C)(C)C)c1 |
| InChI | InChI=1S/C29H33N3O7/c1-29(2,3)32-28(35)19-14-20(30-26(33)17-38-24-12-8-6-10-22(24)36-4)16-21(15-19)31-27(34)18-39-25-13-9-7-11-23(25)37-5/h6-16H,17-18H2,1-5H3,(H,30,33)(H,31,34)(H,32,35) |
| InChIKey | ORTGBNVGVSPAEZ-UHFFFAOYSA-N |
| XLogP | 4.27 |
| TPSA | 124.22 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 39 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.60 |
| LogP ≤ 5 | 4.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |