C15H14Cl2N2O3 — CID 51193233
N-(4-amino-3,5-dichlorophenyl)-2-(2-methoxyphenoxy)acetamide (PubChem CID 51193233) has the molecular formula C15H14Cl2N2O3 and a molecular weight of 341.19 g/mol. Its IUPAC name is N-(4-amino-3,5-dichlorophenyl)-2-(2-methoxyphenoxy)acetamide.
| Compound Name | N-(4-amino-3,5-dichlorophenyl)-2-(2-methoxyphenoxy)acetamide |
|---|---|
| PubChem CID | 51193233 |
| Molecular Formula | C15H14Cl2N2O3 |
| Molecular Weight | 341.19 g/mol |
| Exact Mass | 340.04 |
| IUPAC Name | N-(4-amino-3,5-dichlorophenyl)-2-(2-methoxyphenoxy)acetamide |
| SMILES | COc1ccccc1OCC(=O)Nc1cc(Cl)c(N)c(Cl)c1 |
| InChI | InChI=1S/C15H14Cl2N2O3/c1-21-12-4-2-3-5-13(12)22-8-14(20)19-9-6-10(16)15(18)11(17)7-9/h2-7H,8,18H2,1H3,(H,19,20) |
| InChIKey | PVYYUTVXSCMVGK-UHFFFAOYSA-N |
| XLogP | 3.60 |
| TPSA | 73.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 341.19 |
| LogP ≤ 5 | 3.60 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|