C20H21ClN2O6 — CID 2705826
[2-(ethylamino)-2-oxoethyl] 2-[2-(3-chloro-4-methoxyanilino)-2-oxoethoxy]benzoate (PubChem CID 2705826) has the molecular formula C20H21ClN2O6 and a molecular weight of 420.85 g/mol. Its IUPAC name is [2-(ethylamino)-2-oxoethyl] 2-[2-(3-chloro-4-methoxyanilino)-2-oxoethoxy]benzoate.
| Compound Name | [2-(ethylamino)-2-oxoethyl] 2-[2-(3-chloro-4-methoxyanilino)-2-oxoethoxy]benzoate |
|---|---|
| PubChem CID | 2705826 |
| Molecular Formula | C20H21ClN2O6 |
| Molecular Weight | 420.85 g/mol |
| Exact Mass | 420.11 |
| IUPAC Name | [2-(ethylamino)-2-oxoethyl] 2-[2-(3-chloro-4-methoxyanilino)-2-oxoethoxy]benzoate |
| SMILES | CCNC(=O)COC(=O)c1ccccc1OCC(=O)Nc1ccc(OC)c(Cl)c1 |
| InChI | InChI=1S/C20H21ClN2O6/c1-3-22-18(24)11-29-20(26)14-6-4-5-7-16(14)28-12-19(25)23-13-8-9-17(27-2)15(21)10-13/h4-10H,3,11-12H2,1-2H3,(H,22,24)(H,23,25) |
| InChIKey | LCAUSWMROWLNRD-UHFFFAOYSA-N |
| XLogP | 2.66 |
| TPSA | 102.96 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.85 |
| LogP ≤ 5 | 2.66 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |