C18H17ClN2O5S — CID 27065875
[2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate (PubChem CID 27065875) has the molecular formula C18H17ClN2O5S and a molecular weight of 408.86 g/mol. Its IUPAC name is [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate.
| Compound Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 27065875 |
| Molecular Formula | C18H17ClN2O5S |
| Molecular Weight | 408.86 g/mol |
| Exact Mass | 408.05 |
| IUPAC Name | [2-(3-chloro-4-methoxyanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
| SMILES | COc1ccc(NC(=O)COC(=O)c2ccccc2SCC(N)=O)cc1Cl |
| InChI | InChI=1S/C18H17ClN2O5S/c1-25-14-7-6-11(8-13(14)19)21-17(23)9-26-18(24)12-4-2-3-5-15(12)27-10-16(20)22/h2-8H,9-10H2,1H3,(H2,20,22)(H,21,23) |
| InChIKey | HYKXNULMICWJHK-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 107.72 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 408.86 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |