C17H14ClN3O6S — CID 27066088
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate (PubChem CID 27066088) has the molecular formula C17H14ClN3O6S and a molecular weight of 423.83 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
|---|---|
| PubChem CID | 27066088 |
| Molecular Formula | C17H14ClN3O6S |
| Molecular Weight | 423.83 g/mol |
| Exact Mass | 423.03 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(2-amino-2-oxoethyl)sulfanylbenzoate |
| SMILES | NC(=O)CSc1ccccc1C(=O)OCC(=O)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H14ClN3O6S/c18-12-7-10(21(25)26)5-6-13(12)20-16(23)8-27-17(24)11-3-1-2-4-14(11)28-9-15(19)22/h1-7H,8-9H2,(H2,19,22)(H,20,23) |
| InChIKey | TVCUHWQNYBCWQP-UHFFFAOYSA-N |
| XLogP | 2.62 |
| TPSA | 141.63 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.83 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|