C23H19ClN2O5 — CID 18228536
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(2-phenylethyl)benzoate (PubChem CID 18228536) has the molecular formula C23H19ClN2O5 and a molecular weight of 438.87 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(2-phenylethyl)benzoate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(2-phenylethyl)benzoate |
|---|---|
| PubChem CID | 18228536 |
| Molecular Formula | C23H19ClN2O5 |
| Molecular Weight | 438.87 g/mol |
| Exact Mass | 438.10 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 2-(2-phenylethyl)benzoate |
| SMILES | O=C(COC(=O)c1ccccc1CCc1ccccc1)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C23H19ClN2O5/c24-20-14-18(26(29)30)12-13-21(20)25-22(27)15-31-23(28)19-9-5-4-8-17(19)11-10-16-6-2-1-3-7-16/h1-9,12-14H,10-11,15H2,(H,25,27) |
| InChIKey | GEXBLPCSPDFUPK-UHFFFAOYSA-N |
| XLogP | 4.83 |
| TPSA | 98.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 438.87 |
| LogP ≤ 5 | 4.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|