C17H12ClN3O9 — CID 29483188
[2-(2-chloro-4-nitroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 29483188) has the molecular formula C17H12ClN3O9 and a molecular weight of 437.75 g/mol. Its IUPAC name is [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 29483188 |
| Molecular Formula | C17H12ClN3O9 |
| Molecular Weight | 437.75 g/mol |
| Exact Mass | 437.03 |
| IUPAC Name | [2-(2-chloro-4-nitroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)Nc1ccc([N+](=O)[O-])cc1Cl |
| InChI | InChI=1S/C17H12ClN3O9/c18-11-5-9(20(24)25)1-2-12(11)19-16(22)8-30-17(23)10-6-14-15(29-4-3-28-14)7-13(10)21(26)27/h1-2,5-7H,3-4,8H2,(H,19,22) |
| InChIKey | HEUHHOMMZQFDJW-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.75 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|