C17H13N3O9 — CID 30966205
[2-(2-nitroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 30966205) has the molecular formula C17H13N3O9 and a molecular weight of 403.30 g/mol. Its IUPAC name is [2-(2-nitroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [2-(2-nitroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 30966205 |
| Molecular Formula | C17H13N3O9 |
| Molecular Weight | 403.30 g/mol |
| Exact Mass | 403.07 |
| IUPAC Name | [2-(2-nitroanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)Nc1ccccc1[N+](=O)[O-] |
| InChI | InChI=1S/C17H13N3O9/c21-16(18-11-3-1-2-4-12(11)19(23)24)9-29-17(22)10-7-14-15(28-6-5-27-14)8-13(10)20(25)26/h1-4,7-8H,5-6,9H2,(H,18,21) |
| InChIKey | TUXYVXGKIZCDSL-UHFFFAOYSA-N |
| XLogP | 2.07 |
| TPSA | 160.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.30 |
| LogP ≤ 5 | 2.07 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|