C20H18N2O9 — CID 30966319
[2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 30966319) has the molecular formula C20H18N2O9 and a molecular weight of 430.37 g/mol. Its IUPAC name is [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 30966319 |
| Molecular Formula | C20H18N2O9 |
| Molecular Weight | 430.37 g/mol |
| Exact Mass | 430.10 |
| IUPAC Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | O=C(COC(=O)c1cc2c(cc1[N+](=O)[O-])OCCO2)NC[C@H]1COc2ccccc2O1 |
| InChI | InChI=1S/C20H18N2O9/c23-19(21-9-12-10-29-15-3-1-2-4-16(15)31-12)11-30-20(24)13-7-17-18(28-6-5-27-17)8-14(13)22(25)26/h1-4,7-8,12H,5-6,9-11H2,(H,21,23)/t12-/m0/s1 |
| InChIKey | GTBYOXOZUUAYMC-LBPRGKRZSA-N |
| XLogP | 1.48 |
| TPSA | 135.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.37 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|