C19H19N3O7 — CID 7432529
[2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate (PubChem CID 7432529) has the molecular formula C19H19N3O7 and a molecular weight of 401.38 g/mol. Its IUPAC name is [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate.
| Compound Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
|---|---|
| PubChem CID | 7432529 |
| Molecular Formula | C19H19N3O7 |
| Molecular Weight | 401.38 g/mol |
| Exact Mass | 401.12 |
| IUPAC Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 4-(methylamino)-3-nitrobenzoate |
| SMILES | CNc1ccc(C(=O)OCC(=O)NC[C@H]2COc3ccccc3O2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H19N3O7/c1-20-14-7-6-12(8-15(14)22(25)26)19(24)28-11-18(23)21-9-13-10-27-16-4-2-3-5-17(16)29-13/h2-8,13,20H,9-11H2,1H3,(H,21,23)/t13-/m0/s1 |
| InChIKey | XCUBWFJJHSYIQZ-ZDUSSCGKSA-N |
| XLogP | 1.75 |
| TPSA | 129.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.38 |
| LogP ≤ 5 | 1.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|