C19H18N2O7 — CID 7434501
[2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate (PubChem CID 7434501) has the molecular formula C19H18N2O7 and a molecular weight of 386.36 g/mol. Its IUPAC name is [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate.
| Compound Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate |
|---|---|
| PubChem CID | 7434501 |
| Molecular Formula | C19H18N2O7 |
| Molecular Weight | 386.36 g/mol |
| Exact Mass | 386.11 |
| IUPAC Name | [2-[[(3S)-2,3-dihydro-1,4-benzodioxin-3-yl]methylamino]-2-oxoethyl] 4-methyl-3-nitrobenzoate |
| SMILES | Cc1ccc(C(=O)OCC(=O)NC[C@H]2COc3ccccc3O2)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C19H18N2O7/c1-12-6-7-13(8-15(12)21(24)25)19(23)27-11-18(22)20-9-14-10-26-16-4-2-3-5-17(16)28-14/h2-8,14H,9-11H2,1H3,(H,20,22)/t14-/m0/s1 |
| InChIKey | LNBFRAMLQUAEFO-AWEZNQCLSA-N |
| XLogP | 2.02 |
| TPSA | 117.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 386.36 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|