C18H12ClN3O7 — CID 30966218
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate (PubChem CID 30966218) has the molecular formula C18H12ClN3O7 and a molecular weight of 417.76 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
|---|---|
| PubChem CID | 30966218 |
| Molecular Formula | C18H12ClN3O7 |
| Molecular Weight | 417.76 g/mol |
| Exact Mass | 417.04 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 6-nitro-2,3-dihydro-1,4-benzodioxine-7-carboxylate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)c2cc3c(cc2[N+](=O)[O-])OCCO3)cc1Cl |
| InChI | InChI=1S/C18H12ClN3O7/c19-13-5-11(2-1-10(13)8-20)21-17(23)9-29-18(24)12-6-15-16(28-4-3-27-15)7-14(12)22(25)26/h1-2,5-7H,3-4,9H2,(H,21,23) |
| InChIKey | VBXBKGSRZDZSIR-UHFFFAOYSA-N |
| XLogP | 2.69 |
| TPSA | 140.79 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 417.76 |
| LogP ≤ 5 | 2.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|