C15H11ClN2O3S — CID 2502300
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-methylthiophene-2-carboxylate (PubChem CID 2502300) has the molecular formula C15H11ClN2O3S and a molecular weight of 334.78 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-methylthiophene-2-carboxylate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-methylthiophene-2-carboxylate |
|---|---|
| PubChem CID | 2502300 |
| Molecular Formula | C15H11ClN2O3S |
| Molecular Weight | 334.78 g/mol |
| Exact Mass | 334.02 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 3-methylthiophene-2-carboxylate |
| SMILES | Cc1ccsc1C(=O)OCC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C15H11ClN2O3S/c1-9-4-5-22-14(9)15(20)21-8-13(19)18-11-3-2-10(7-17)12(16)6-11/h2-6H,8H2,1H3,(H,18,19) |
| InChIKey | HPQFHDIWYLSKSA-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 334.78 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |