C13H13ClN2O4 — CID 8014507
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-ethoxyacetate (PubChem CID 8014507) has the molecular formula C13H13ClN2O4 and a molecular weight of 296.71 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-ethoxyacetate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-ethoxyacetate |
|---|---|
| PubChem CID | 8014507 |
| Molecular Formula | C13H13ClN2O4 |
| Molecular Weight | 296.71 g/mol |
| Exact Mass | 296.06 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 2-ethoxyacetate |
| SMILES | CCOCC(=O)OCC(=O)Nc1ccc(C#N)c(Cl)c1 |
| InChI | InChI=1S/C13H13ClN2O4/c1-2-19-8-13(18)20-7-12(17)16-10-4-3-9(6-15)11(14)5-10/h3-5H,2,7-8H2,1H3,(H,16,17) |
| InChIKey | KNEFJDNRPHWSOM-UHFFFAOYSA-N |
| XLogP | 1.73 |
| TPSA | 88.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.71 |
| LogP ≤ 5 | 1.73 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |