C19H14ClFN2O4 — CID 7967515
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 7967515) has the molecular formula C19H14ClFN2O4 and a molecular weight of 388.78 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 7967515 |
| Molecular Formula | C19H14ClFN2O4 |
| Molecular Weight | 388.78 g/mol |
| Exact Mass | 388.06 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)CCC(=O)c2ccc(F)cc2)cc1Cl |
| InChI | InChI=1S/C19H14ClFN2O4/c20-16-9-15(6-3-13(16)10-22)23-18(25)11-27-19(26)8-7-17(24)12-1-4-14(21)5-2-12/h1-6,9H,7-8,11H2,(H,23,25) |
| InChIKey | OBDKURDVKFJRTC-UHFFFAOYSA-N |
| XLogP | 3.50 |
| TPSA | 96.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.78 |
| LogP ≤ 5 | 3.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |