C18H13Cl3FNO4 — CID 35564457
[2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-(4-fluorophenyl)-4-oxobutanoate (PubChem CID 35564457) has the molecular formula C18H13Cl3FNO4 and a molecular weight of 432.66 g/mol. Its IUPAC name is [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-(4-fluorophenyl)-4-oxobutanoate.
| Compound Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
|---|---|
| PubChem CID | 35564457 |
| Molecular Formula | C18H13Cl3FNO4 |
| Molecular Weight | 432.66 g/mol |
| Exact Mass | 430.99 |
| IUPAC Name | [2-oxo-2-(2,4,5-trichloroanilino)ethyl] 4-(4-fluorophenyl)-4-oxobutanoate |
| SMILES | O=C(COC(=O)CCC(=O)c1ccc(F)cc1)Nc1cc(Cl)c(Cl)cc1Cl |
| InChI | InChI=1S/C18H13Cl3FNO4/c19-12-7-14(21)15(8-13(12)20)23-17(25)9-27-18(26)6-5-16(24)10-1-3-11(22)4-2-10/h1-4,7-8H,5-6,9H2,(H,23,25) |
| InChIKey | DMEQHCIAPQPXLI-UHFFFAOYSA-N |
| XLogP | 4.93 |
| TPSA | 72.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 432.66 |
| LogP ≤ 5 | 4.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'} |
|---|