C19H16Cl2N2O3S — CID 18271373
[2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate (PubChem CID 18271373) has the molecular formula C19H16Cl2N2O3S and a molecular weight of 423.32 g/mol. Its IUPAC name is [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate.
| Compound Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate |
|---|---|
| PubChem CID | 18271373 |
| Molecular Formula | C19H16Cl2N2O3S |
| Molecular Weight | 423.32 g/mol |
| Exact Mass | 422.03 |
| IUPAC Name | [2-(3-chloro-4-cyanoanilino)-2-oxoethyl] 4-(4-chlorophenyl)sulfanylbutanoate |
| SMILES | N#Cc1ccc(NC(=O)COC(=O)CCCSc2ccc(Cl)cc2)cc1Cl |
| InChI | InChI=1S/C19H16Cl2N2O3S/c20-14-4-7-16(8-5-14)27-9-1-2-19(25)26-12-18(24)23-15-6-3-13(11-22)17(21)10-15/h3-8,10H,1-2,9,12H2,(H,23,24) |
| InChIKey | FUDZUXKLXJREIA-UHFFFAOYSA-N |
| XLogP | 4.92 |
| TPSA | 79.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.32 |
| LogP ≤ 5 | 4.92 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|